C8H17N5 — CID 136590848
N,N,2,5-tetramethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine (PubChem CID 136590848) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is N,N,2,5-tetramethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine.
| Compound Name | N,N,2,5-tetramethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590848 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | N,N,2,5-tetramethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine |
| SMILES | C/N=C1\NC(C)N=C(N(C)C)N1C |
| InChI | InChI=1S/C8H17N5/c1-6-10-7(9-2)13(5)8(11-6)12(3)4/h6H,1-5H3,(H,9,10) |
| InChIKey | SQNGLDMOUXNCPB-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|