C5H11N5 — CID 136590856
(2S)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136590856) has the molecular formula C5H11N5 and a molecular weight of 141.18 g/mol. Its IUPAC name is (2S)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | (2S)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590856 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (2S)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | C/N=C1/NC(N)=N[C@@H](C)N1 |
| InChI | InChI=1S/C5H11N5/c1-3-8-4(6)10-5(7-2)9-3/h3H,1-2H3,(H4,6,7,8,9,10)/t3-/m1/s1 |
| InChIKey | XPSOXJSYPIABTG-GSVOUGTGSA-N |
| XLogP | -1.17 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|