C8H17N5 — CID 136590863
N-ethyl-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136590863) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is N-ethyl-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N-ethyl-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590863 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | N-ethyl-N,2-dimethyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | CCN(C)C1=NC(C)N/C(=N\C)N1 |
| InChI | InChI=1S/C8H17N5/c1-5-13(4)8-11-6(2)10-7(9-3)12-8/h6H,5H2,1-4H3,(H2,9,10,11,12) |
| InChIKey | HNOGEUUJAZAUFL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|