C12H17N5 — CID 136590894
N,2-dimethyl-6-methylimino-N-phenyl-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136590894) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is N,2-dimethyl-6-methylimino-N-phenyl-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N,2-dimethyl-6-methylimino-N-phenyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590894 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N,2-dimethyl-6-methylimino-N-phenyl-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | C/N=C1/NC(N(C)c2ccccc2)=NC(C)N1 |
| InChI | InChI=1S/C12H17N5/c1-9-14-11(13-2)16-12(15-9)17(3)10-7-5-4-6-8-10/h4-9H,1-3H3,(H2,13,14,15,16) |
| InChIKey | UXQWWUSCRGLCCP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|