C9H13N5O — CID 136590947
N-(furan-2-yl)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136590947) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is N-(furan-2-yl)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N-(furan-2-yl)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590947 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-(furan-2-yl)-2-methyl-6-methylimino-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | C/N=C1/NC(Nc2ccco2)=NC(C)N1 |
| InChI | InChI=1S/C9H13N5O/c1-6-11-8(10-2)14-9(12-6)13-7-4-3-5-15-7/h3-6H,1-2H3,(H3,10,11,12,13,14) |
| InChIKey | SNYWCBWFHFRDGA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|