C10H16N6 — CID 136590950
N,2-dimethyl-6-methylimino-N-(1H-pyrrol-2-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine (PubChem CID 136590950) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is N,2-dimethyl-6-methylimino-N-(1H-pyrrol-2-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine.
| Compound Name | N,2-dimethyl-6-methylimino-N-(1H-pyrrol-2-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590950 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N,2-dimethyl-6-methylimino-N-(1H-pyrrol-2-yl)-2,5-dihydro-1H-1,3,5-triazin-4-amine |
| SMILES | C/N=C1/NC(N(C)c2ccc[nH]2)=NC(C)N1 |
| InChI | InChI=1S/C10H16N6/c1-7-13-9(11-2)15-10(14-7)16(3)8-5-4-6-12-8/h4-7,12H,1-3H3,(H2,11,13,14,15) |
| InChIKey | OIKVVOQERCMCOU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|