C19H23N5O — CID 136592371
16-methyl-8,14,19,21,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,15(22),16,18-hexaen-7-one (PubChem CID 136592371) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 16-methyl-8,14,19,21,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,15(22),16,18-hexaen-7-one.
| Compound Name | 16-methyl-8,14,19,21,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,15(22),16,18-hexaen-7-one |
|---|---|
| PubChem CID | 136592371 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 16-methyl-8,14,19,21,22-pentazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,15(22),16,18-hexaen-7-one |
| SMILES | Cc1cc2ncc3n2nc1NCCCCCNC(=O)C1C=C3C=CC1 |
| InChI | InChI=1S/C19H23N5O/c1-13-10-17-22-12-16-14-6-5-7-15(11-14)19(25)21-9-4-2-3-8-20-18(13)23-24(16)17/h5-6,10-12,15H,2-4,7-9H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | VDGBIBCNZGFHAM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |