C19H22N4O2 — CID 136592379
17-methyl-7-oxa-14,19,21,22-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18-heptaen-5-ol (PubChem CID 136592379) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 17-methyl-7-oxa-14,19,21,22-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18-heptaen-5-ol.
| Compound Name | 17-methyl-7-oxa-14,19,21,22-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18-heptaen-5-ol |
|---|---|
| PubChem CID | 136592379 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 17-methyl-7-oxa-14,19,21,22-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18-heptaen-5-ol |
| SMILES | Cc1cc2nn3c(cnc13)-c1ccc(O)c(c1)OCCCCCCN2 |
| InChI | InChI=1S/C19H22N4O2/c1-13-10-18-20-8-4-2-3-5-9-25-17-11-14(6-7-16(17)24)15-12-21-19(13)23(15)22-18/h6-7,10-12,24H,2-5,8-9H2,1H3,(H,20,22) |
| InChIKey | XPRWBQCDBPUEDC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |