C12H13BrF3N6O+ — CID 136592722
2-bromo-8-methyl-4-(5,5,5-trifluoropentyl)-1H-[1,2,4]triazolo[5,1-f]purin-3-ium-5-one (PubChem CID 136592722) has the molecular formula C12H13BrF3N6O+ and a molecular weight of 394.18 g/mol. Its IUPAC name is 2-bromo-8-methyl-4-(5,5,5-trifluoropentyl)-1H-[1,2,4]triazolo[5,1-f]purin-3-ium-5-one.
| Compound Name | 2-bromo-8-methyl-4-(5,5,5-trifluoropentyl)-1H-[1,2,4]triazolo[5,1-f]purin-3-ium-5-one |
|---|---|
| PubChem CID | 136592722 |
| Molecular Formula | C12H13BrF3N6O+ |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-bromo-8-methyl-4-(5,5,5-trifluoropentyl)-1H-[1,2,4]triazolo[5,1-f]purin-3-ium-5-one |
| SMILES | Cc1nc2c3[nH]c(Br)[nH+]c3n(CCCCC(F)(F)F)c(=O)n2n1 |
| InChI | InChI=1S/C12H12BrF3N6O/c1-6-17-9-7-8(19-10(13)18-7)21(11(23)22(9)20-6)5-3-2-4-12(14,15)16/h2-5H2,1H3,(H,18,19)/p+1 |
| InChIKey | NMRNNZIIWYCSQC-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|