C30H33ClN2O7 — CID 136593528
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione (PubChem CID 136593528) has the molecular formula C30H33ClN2O7 and a molecular weight of 569.05 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 136593528 |
| Molecular Formula | C30H33ClN2O7 |
| Molecular Weight | 569.05 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4cc(OC)c(OC)cc4c(=O)[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C30H33ClN2O7/c1-37-24-9-8-17(12-21(24)31)10-11-30(18-6-4-5-7-18)16-23(34)20(29(36)40-30)14-27-32-22-15-26(39-3)25(38-2)13-19(22)28(35)33-27/h8-9,12-13,15,18,20H,4-7,10-11,14,16H2,1-3H3,(H,32,33,35) |
| InChIKey | VDJSRJWFHCIVSM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.05 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|