C9H13N3 — CID 136593559
2,4-dimethyl-6,7-dihydro-1,2,4-benzotriazin-2-ium-1-ide (PubChem CID 136593559) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 2,4-dimethyl-6,7-dihydro-1,2,4-benzotriazin-2-ium-1-ide.
| Compound Name | 2,4-dimethyl-6,7-dihydro-1,2,4-benzotriazin-2-ium-1-ide |
|---|---|
| PubChem CID | 136593559 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2,4-dimethyl-6,7-dihydro-1,2,4-benzotriazin-2-ium-1-ide |
| SMILES | CN1C=[N+](C)[N-]C2=CCCC=C21 |
| InChI | InChI=1S/C9H13N3/c1-11-7-12(2)10-8-5-3-4-6-9(8)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | XXEYJRGEQSMHNX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 20.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|