C24H36N6O4S — CID 136594849
2-[bis(dimethylamino)methyl]-6-[[4-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]-methylamino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]phenol (PubChem CID 136594849) has the molecular formula C24H36N6O4S and a molecular weight of 504.66 g/mol. Its IUPAC name is 2-[bis(dimethylamino)methyl]-6-[[4-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]-methylamino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]phenol.
| Compound Name | 2-[bis(dimethylamino)methyl]-6-[[4-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]-methylamino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]phenol |
|---|---|
| PubChem CID | 136594849 |
| Molecular Formula | C24H36N6O4S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 2-[bis(dimethylamino)methyl]-6-[[4-[[(1R)-2,2-dimethyl-1-(5-methylfuran-2-yl)propyl]-methylamino]-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]phenol |
| SMILES | Cc1ccc([C@H](N(C)C2=NS(=O)(=O)N=C2Nc2cccc(C(N(C)C)N(C)C)c2O)C(C)(C)C)o1 |
| InChI | InChI=1S/C24H36N6O4S/c1-15-13-14-18(34-15)20(24(2,3)4)30(9)22-21(26-35(32,33)27-22)25-17-12-10-11-16(19(17)31)23(28(5)6)29(7)8/h10-14,20,23,31H,1-9H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | LTZIMXZPBCTDFV-FQEVSTJZSA-N |
| XLogP | 3.60 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|