C22H29N5O5S — CID 136594915
6-tert-butyl-2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide (PubChem CID 136594915) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 6-tert-butyl-2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide.
| Compound Name | 6-tert-butyl-2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 136594915 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 6-tert-butyl-2-hydroxy-N-methyl-3-[[4-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2,5-thiadiazol-3-yl]amino]benzamide |
| SMILES | CC[C@@H](/N=C1\NS(=O)(=O)N=C1Nc1ccc(C(C)(C)C)c(C(=O)NC)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C22H29N5O5S/c1-7-14(16-11-8-12(2)32-16)24-19-20(27-33(30,31)26-19)25-15-10-9-13(22(3,4)5)17(18(15)28)21(29)23-6/h8-11,14,28H,7H2,1-6H3,(H,23,29)(H,24,26)(H,25,27)/t14-/m1/s1 |
| InChIKey | GHGZWDMDPOLNJF-CQSZACIVSA-N |
| XLogP | 3.16 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|