C30H35N3O2S — CID 136595209
N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide (PubChem CID 136595209) has the molecular formula C30H35N3O2S and a molecular weight of 501.70 g/mol. Its IUPAC name is N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 136595209 |
| Molecular Formula | C30H35N3O2S |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N-[[4-[[[(3aR,9bS)-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC(C/N=C2\C[C@H]3c4ccccc4CC[C@H]3N2)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H35N3O2S/c34-36(35,26-15-13-23-5-1-2-7-25(23)17-26)32-20-22-11-9-21(10-12-22)19-31-30-18-28-27-8-4-3-6-24(27)14-16-29(28)33-30/h1-8,13,15,17,21-22,28-29,32H,9-12,14,16,18-20H2,(H,31,33)/t21?,22?,28-,29+/m0/s1 |
| InChIKey | QVOMHTRKJGFVGT-ISGXWMPLSA-N |
| XLogP | 5.41 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|