C9H12N4O3 — CID 136595506
4-(hydroxyiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one (PubChem CID 136595506) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-(hydroxyiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one.
| Compound Name | 4-(hydroxyiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 136595506 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-(hydroxyiminomethyl)-2,5-dimethyl-6,7-dihydropyridazino[3,4-b][1,4]oxazin-3-one |
| SMILES | CN1CCOc2nn(C)c(=O)c(C=NO)c21 |
| InChI | InChI=1S/C9H12N4O3/c1-12-3-4-16-8-7(12)6(5-10-15)9(14)13(2)11-8/h5,15H,3-4H2,1-2H3 |
| InChIKey | XRBIRZCVMKETPN-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|