C12H9N3O — CID 136595527
3-[2-(1H-indol-2-yl)ethenyl]-1,2,4-oxadiazole (PubChem CID 136595527) has the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-[2-(1H-indol-2-yl)ethenyl]-1,2,4-oxadiazole.
| Compound Name | 3-[2-(1H-indol-2-yl)ethenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 136595527 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 3-[2-(1H-indol-2-yl)ethenyl]-1,2,4-oxadiazole |
| SMILES | C(=Cc1cc2ccccc2[nH]1)c1ncon1 |
| InChI | InChI=1S/C12H9N3O/c1-2-4-11-9(3-1)7-10(14-11)5-6-12-13-8-16-15-12/h1-8,14H |
| InChIKey | VSNPPMRXBJUGAS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |