C25H27IN6O2 — CID 136595939
2-[4-[[2-hydroxy-2-[3-(iodomethyl)phenyl]ethyl]amino]-2-oxo-1H-pyridin-3-yl]-N,N',7-trimethyl-3H-benzimidazole-5-carboximidamide (PubChem CID 136595939) has the molecular formula C25H27IN6O2 and a molecular weight of 570.44 g/mol. Its IUPAC name is 2-[4-[[2-hydroxy-2-[3-(iodomethyl)phenyl]ethyl]amino]-2-oxo-1H-pyridin-3-yl]-N,N',7-trimethyl-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[4-[[2-hydroxy-2-[3-(iodomethyl)phenyl]ethyl]amino]-2-oxo-1H-pyridin-3-yl]-N,N',7-trimethyl-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 136595939 |
| Molecular Formula | C25H27IN6O2 |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 2-[4-[[2-hydroxy-2-[3-(iodomethyl)phenyl]ethyl]amino]-2-oxo-1H-pyridin-3-yl]-N,N',7-trimethyl-3H-benzimidazole-5-carboximidamide |
| SMILES | C/N=C(\NC)c1cc(C)c2nc(-c3c(NCC(O)c4cccc(CI)c4)cc[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C25H27IN6O2/c1-14-9-17(23(27-2)28-3)11-19-22(14)32-24(31-19)21-18(7-8-29-25(21)34)30-13-20(33)16-6-4-5-15(10-16)12-26/h4-11,20,33H,12-13H2,1-3H3,(H,27,28)(H,31,32)(H2,29,30,34) |
| InChIKey | DRSGWXHUEWWQHU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|