C19H17F3N4O3 — CID 136596046
[5-(3,4-dihydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 136596046) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is [5-(3,4-dihydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [5-(3,4-dihydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 136596046 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [5-(3,4-dihydroxyphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cnn2c(C(F)(F)F)cc(-c3ccc(O)c(O)c3)nc12)N1CCCCC1 |
| InChI | InChI=1S/C19H17F3N4O3/c20-19(21,22)16-9-13(11-4-5-14(27)15(28)8-11)24-17-12(10-23-26(16)17)18(29)25-6-2-1-3-7-25/h4-5,8-10,27-28H,1-3,6-7H2 |
| InChIKey | LQRITWLSGQIIAM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|