C25H26N4O4 — CID 136596100
4-[4-[[3-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid (PubChem CID 136596100) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 4-[4-[[3-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid.
| Compound Name | 4-[4-[[3-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 136596100 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 4-[4-[[3-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-2-hydroxyphenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]butanoic acid |
| SMILES | Cc1[nH]n(CCCC(=O)O)c(=O)c1/N=N/c1cccc(/C=C2\CCCc3ccccc32)c1O |
| InChI | InChI=1S/C25H26N4O4/c1-16-23(25(33)29(28-16)14-6-13-22(30)31)27-26-21-12-5-10-19(24(21)32)15-18-9-4-8-17-7-2-3-11-20(17)18/h2-3,5,7,10-12,15,28,32H,4,6,8-9,13-14H2,1H3,(H,30,31)/b18-15+,27-26+ |
| InChIKey | QGUGPFCQYGKORX-HFCRWDTPSA-N |
| XLogP | 5.35 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|