About 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one
5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 136596195) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 136596195 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1nn(C)c2c(=O)[nH]c(N)nc12 |
| InChI | InChI=1S/C7H9N5O/c1-3-4-5(12(2)11-3)6(13)10-7(8)9-4/h1-2H3,(H3,8,9,10,13) |
| InChIKey | KQFBHUGRVJOKQV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CID 136596195) is 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is Cc1nn(C)c2c(=O)[nH]c(N)nc12.
What is the InChIKey of 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is KQFBHUGRVJOKQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-3-4-5(12(2)11-3)6(13)10-7(8)9-4/h1-2H3,(H3,8,9,10,13).
What are the key properties of 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 179.18 g/mol, XLogP of -0.45, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 136596195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).