C19H16ClN3O2S — CID 136597464
4-(4-chloro-3-methyl-3,4-dihydronaphthalen-1-yl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 136597464) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is 4-(4-chloro-3-methyl-3,4-dihydronaphthalen-1-yl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-chloro-3-methyl-3,4-dihydronaphthalen-1-yl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136597464 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-(4-chloro-3-methyl-3,4-dihydronaphthalen-1-yl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC1C=C(n2c(-c3ccc(O)cc3O)n[nH]c2=S)c2ccccc2C1Cl |
| InChI | InChI=1S/C19H16ClN3O2S/c1-10-8-15(12-4-2-3-5-13(12)17(10)20)23-18(21-22-19(23)26)14-7-6-11(24)9-16(14)25/h2-10,17,24-25H,1H3,(H,22,26) |
| InChIKey | YPZNVHSWWPSKIR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|