About N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine
N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine (PubChem CID 136598227) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine |
| PubChem CID | 136598227 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine |
| SMILES | CCCCN1CCN=C1C=NO |
| InChI | InChI=1S/C8H15N3O/c1-2-3-5-11-6-4-9-8(11)7-10-12/h7,12H,2-6H2,1H3 |
| InChIKey | RXGPJUBQAMGEOQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine?
The IUPAC name of N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine (CID 136598227) is N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine.
What is the SMILES notation for N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine?
The canonical SMILES for N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine is CCCCN1CCN=C1C=NO.
What is the InChIKey of N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine?
The InChIKey is RXGPJUBQAMGEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-2-3-5-11-6-4-9-8(11)7-10-12/h7,12H,2-6H2,1H3.
What are the key properties of N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine?
N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine has a molecular weight of 169.23 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-butyl-4,5-dihydroimidazol-2-yl)methylidene]hydroxylamine is sourced from PubChem (CID 136598227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).