C13H15FN4O4 — CID 136598784
7-[(2S,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-3H-imidazo[2,1-f][1,2,4]triazin-4-one (PubChem CID 136598784) has the molecular formula C13H15FN4O4 and a molecular weight of 310.29 g/mol. Its IUPAC name is 7-[(2S,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-3H-imidazo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 7-[(2S,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 136598784 |
| Molecular Formula | C13H15FN4O4 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 7-[(2S,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methyl-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
| SMILES | C=C[C@]1(CO)O[C@@H](c2cnc3c(=O)[nH]c(C)nn23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C13H15FN4O4/c1-3-13(5-19)10(20)8(14)9(22-13)7-4-15-11-12(21)16-6(2)17-18(7)11/h3-4,8-10,19-20H,1,5H2,2H3,(H,16,17,21)/t8-,9-,10-,13+/m0/s1 |
| InChIKey | VJTUJGXDNMGYQX-AVWBDOJWSA-N |
| XLogP | -0.59 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|