C22H28N3O3P — CID 136599053
ethane;4-hydroxy-1-methyl-3-(1-methyl-1-oxo-4H-2,4,1λ5-benzodiazaphosphinin-3-yl)quinolin-2-one (PubChem CID 136599053) has the molecular formula C22H28N3O3P and a molecular weight of 413.46 g/mol. Its IUPAC name is ethane;4-hydroxy-1-methyl-3-(1-methyl-1-oxo-4H-2,4,1λ5-benzodiazaphosphinin-3-yl)quinolin-2-one.
| Compound Name | ethane;4-hydroxy-1-methyl-3-(1-methyl-1-oxo-4H-2,4,1λ5-benzodiazaphosphinin-3-yl)quinolin-2-one |
|---|---|
| PubChem CID | 136599053 |
| Molecular Formula | C22H28N3O3P |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | ethane;4-hydroxy-1-methyl-3-(1-methyl-1-oxo-4H-2,4,1λ5-benzodiazaphosphinin-3-yl)quinolin-2-one |
| SMILES | CC.CC.Cn1c(=O)c(C2=NP(C)(=O)c3ccccc3N2)c(O)c2ccccc21 |
| InChI | InChI=1S/C18H16N3O3P.2C2H6/c1-21-13-9-5-3-7-11(13)16(22)15(18(21)23)17-19-12-8-4-6-10-14(12)25(2,24)20-17;2*1-2/h3-10,22H,1-2H3,(H,19,20,24);2*1-2H3 |
| InChIKey | AUEWOCZABBVXEM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|