C19H13ClN6OS — CID 136600407
4-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-3-chlorophenol (PubChem CID 136600407) has the molecular formula C19H13ClN6OS and a molecular weight of 408.87 g/mol. Its IUPAC name is 4-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-3-chlorophenol.
| Compound Name | 4-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-3-chlorophenol |
|---|---|
| PubChem CID | 136600407 |
| Molecular Formula | C19H13ClN6OS |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-3-chlorophenol |
| SMILES | [N-]=[N+]=NCc1ccccc1Sc1ccc2nnc(-c3ccc(O)cc3Cl)n2c1 |
| InChI | InChI=1S/C19H13ClN6OS/c20-16-9-13(27)5-7-15(16)19-24-23-18-8-6-14(11-26(18)19)28-17-4-2-1-3-12(17)10-22-25-21/h1-9,11,27H,10H2 |
| InChIKey | SYTGPNBYPFMZPV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|