C42H36F5N3O — CID 136600913
2-[4-(3,5-ditert-butylphenyl)-6-[3-(2,3,4,5,6-pentafluoro-N-pyridin-2-ylanilino)phenyl]-2-pyridinyl]phenol (PubChem CID 136600913) has the molecular formula C42H36F5N3O and a molecular weight of 693.76 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-(2,3,4,5,6-pentafluoro-N-pyridin-2-ylanilino)phenyl]-2-pyridinyl]phenol.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-(2,3,4,5,6-pentafluoro-N-pyridin-2-ylanilino)phenyl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 136600913 |
| Molecular Formula | C42H36F5N3O |
| Molecular Weight | 693.76 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-(2,3,4,5,6-pentafluoro-N-pyridin-2-ylanilino)phenyl]-2-pyridinyl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cccc(N(c4ccccn4)c4c(F)c(F)c(F)c(F)c4F)c3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H36F5N3O/c1-41(2,3)27-18-25(19-28(23-27)42(4,5)6)26-21-31(49-32(22-26)30-14-7-8-15-33(30)51)24-12-11-13-29(20-24)50(34-16-9-10-17-48-34)40-38(46)36(44)35(43)37(45)39(40)47/h7-23,51H,1-6H3 |
| InChIKey | KQMRTJWCMUBYLD-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.76 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|