About 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one
7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 136600944) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 136600944 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCCCNCc1c[nH]c2c(=O)[nH]cnc12 |
| InChI | InChI=1S/C11H16N4O/c1-2-3-4-12-5-8-6-13-10-9(8)14-7-15-11(10)16/h6-7,12-13H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | BYTFXRZVOZIRCB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (CID 136600944) is 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one is CCCCNCc1c[nH]c2c(=O)[nH]cnc12.
What is the InChIKey of 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is BYTFXRZVOZIRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-2-3-4-12-5-8-6-13-10-9(8)14-7-15-11(10)16/h6-7,12-13H,2-5H2,1H3,(H,14,15,16).
What are the key properties of 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one?
7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 220.28 g/mol, XLogP of 1.14, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(butylaminomethyl)-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 136600944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).