C20H21N6O10P — CID 136601341
1H-indol-5-yl 2-[[9-[(2R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]acetate (PubChem CID 136601341) has the molecular formula C20H21N6O10P and a molecular weight of 536.39 g/mol. Its IUPAC name is 1H-indol-5-yl 2-[[9-[(2R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]acetate.
| Compound Name | 1H-indol-5-yl 2-[[9-[(2R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 136601341 |
| Molecular Formula | C20H21N6O10P |
| Molecular Weight | 536.39 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 1H-indol-5-yl 2-[[9-[(2R,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]acetate |
| SMILES | O=C(CNc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)C(O)C2O)c(=O)[nH]1)Oc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C20H21N6O10P/c27-13(35-10-1-2-11-9(5-10)3-4-21-11)6-22-20-24-17-14(18(30)25-20)23-8-26(17)19-16(29)15(28)12(36-19)7-34-37(31,32)33/h1-5,8,12,15-16,19,21,28-29H,6-7H2,(H2,31,32,33)(H2,22,24,25,30)/t12-,15?,16?,19-/m1/s1 |
| InChIKey | GIRUTVCMDCTSEG-BHDXYNENSA-N |
| XLogP | -0.65 |
| TPSA | 234.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.39 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|