C23H22N4O — CID 136601484
2-[2-hydroxy-3-(3-propan-2-ylphenyl)phenyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 136601484) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(3-propan-2-ylphenyl)phenyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[2-hydroxy-3-(3-propan-2-ylphenyl)phenyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 136601484 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[2-hydroxy-3-(3-propan-2-ylphenyl)phenyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3cccc(-c4cccc(C(C)C)c4)c3O)[nH]c2c1 |
| InChI | InChI=1S/C23H22N4O/c1-13(2)14-5-3-6-15(11-14)17-7-4-8-18(21(17)28)23-26-19-10-9-16(22(24)25)12-20(19)27-23/h3-13,28H,1-2H3,(H3,24,25)(H,26,27) |
| InChIKey | IQKOGQXBWQSJGV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|