C19H19NO5S — CID 136601674
5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenol (PubChem CID 136601674) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is 5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenol.
| Compound Name | 5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenol |
|---|---|
| PubChem CID | 136601674 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 5-methoxy-2-[5-(3,4,5-trimethoxyphenyl)-1,2-thiazol-3-yl]phenol |
| SMILES | COc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)sn2)c(O)c1 |
| InChI | InChI=1S/C19H19NO5S/c1-22-12-5-6-13(15(21)9-12)14-10-18(26-20-14)11-7-16(23-2)19(25-4)17(8-11)24-3/h5-10,21H,1-4H3 |
| InChIKey | NCHWVKLZEFESEG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |