C9H14F2N2O2S2 — CID 136601726
(3aR,5S,6S,7R,7aR)-5-(difluoromethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 136601726) has the molecular formula C9H14F2N2O2S2 and a molecular weight of 284.35 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-5-(difluoromethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-5-(difluoromethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 136601726 |
| Molecular Formula | C9H14F2N2O2S2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-5-(difluoromethyl)-2-ethylimino-1,3a,5,6,7,7a-hexahydrothiopyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CC/N=C1/N[C@H]2[C@@H](S1)S[C@H](C(F)F)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C9H14F2N2O2S2/c1-2-12-9-13-3-4(14)5(15)6(7(10)11)16-8(3)17-9/h3-8,14-15H,2H2,1H3,(H,12,13)/t3-,4-,5+,6+,8-/m1/s1 |
| InChIKey | XDEJIMDRAROROE-KYGLGHNPSA-N |
| XLogP | 0.50 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|