C21H24N2O4 — CID 136602210
7-[(2S,3R,4R,5R)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]-3H-furo[3,2-d]pyrimidin-4-one (PubChem CID 136602210) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 7-[(2S,3R,4R,5R)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]-3H-furo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[(2S,3R,4R,5R)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]-3H-furo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136602210 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 7-[(2S,3R,4R,5R)-5-ethyl-3,4-dimethyl-3-phenylmethoxyoxolan-2-yl]-3H-furo[3,2-d]pyrimidin-4-one |
| SMILES | CC[C@H]1O[C@@H](c2coc3c(=O)[nH]cnc23)[C@](C)(OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C21H24N2O4/c1-4-16-13(2)21(3,26-10-14-8-6-5-7-9-14)19(27-16)15-11-25-18-17(15)22-12-23-20(18)24/h5-9,11-13,16,19H,4,10H2,1-3H3,(H,22,23,24)/t13-,16-,19+,21-/m1/s1 |
| InChIKey | RKZQVSDSNZKRES-BNZQBYKSSA-N |
| XLogP | 3.98 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |