C18H15N5O3S — CID 136604958
N-[1-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]furan-2-carboxamide (PubChem CID 136604958) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is N-[1-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[1-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 136604958 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[1-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]furan-2-carboxamide |
| SMILES | CCc1cc(=O)[nH]c(-n2nc(-c3cccs3)cc2NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C18H15N5O3S/c1-2-11-9-16(24)21-18(19-11)23-15(20-17(25)13-5-3-7-26-13)10-12(22-23)14-6-4-8-27-14/h3-10H,2H2,1H3,(H,20,25)(H,19,21,24) |
| InChIKey | SDKHPIFIKQMFSS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |