C18H19N5O4S — CID 136605144
ethyl 2-oxo-2-[[1-(6-oxo-4-propyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]amino]acetate (PubChem CID 136605144) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is ethyl 2-oxo-2-[[1-(6-oxo-4-propyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]amino]acetate.
| Compound Name | ethyl 2-oxo-2-[[1-(6-oxo-4-propyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 136605144 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | ethyl 2-oxo-2-[[1-(6-oxo-4-propyl-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]amino]acetate |
| SMILES | CCCc1cc(=O)[nH]c(-n2nc(-c3cccs3)cc2NC(=O)C(=O)OCC)n1 |
| InChI | InChI=1S/C18H19N5O4S/c1-3-6-11-9-15(24)21-18(19-11)23-14(20-16(25)17(26)27-4-2)10-12(22-23)13-7-5-8-28-13/h5,7-10H,3-4,6H2,1-2H3,(H,20,25)(H,19,21,24) |
| InChIKey | LMZKPNKEDJTXIQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|