C23H21N5O2S — CID 136605331
(Z)-N-[1-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-phenylprop-2-enamide (PubChem CID 136605331) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is (Z)-N-[1-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[1-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 136605331 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (Z)-N-[1-(5-ethyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-thiophen-2-ylpyrazol-5-yl]-3-phenylprop-2-enamide |
| SMILES | CCc1c(C)nc(-n2nc(-c3cccs3)cc2NC(=O)/C=C\c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C23H21N5O2S/c1-3-17-15(2)24-23(26-22(17)30)28-20(14-18(27-28)19-10-7-13-31-19)25-21(29)12-11-16-8-5-4-6-9-16/h4-14H,3H2,1-2H3,(H,25,29)(H,24,26,30)/b12-11- |
| InChIKey | FTCLYBUOFZFOLX-QXMHVHEDSA-N |
| XLogP | 4.21 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|