C13H9N5 — CID 136606784
3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1,3,6,8,10,12,15,17-octaene (PubChem CID 136606784) has the molecular formula C13H9N5 and a molecular weight of 235.25 g/mol. Its IUPAC name is 3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1,3,6,8,10,12,15,17-octaene.
| Compound Name | 3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1,3,6,8,10,12,15,17-octaene |
|---|---|
| PubChem CID | 136606784 |
| Molecular Formula | C13H9N5 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1,3,6,8,10,12,15,17-octaene |
| SMILES | C1=CC2=c3nc[nH]c3=c3ccncc3=NC2N=C1 |
| InChI | InChI=1S/C13H9N5/c1-2-9-12-11(16-7-17-12)8-3-5-14-6-10(8)18-13(9)15-4-1/h1-7,13H,(H,16,17) |
| InChIKey | HASVWDMSNZEYEU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |