C12H19FN2O3S — CID 136607190
(3aR,5R,6R,7R,7aR)-5-[(S)-cyclobutyl(hydroxy)methyl]-7-fluoro-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol (PubChem CID 136607190) has the molecular formula C12H19FN2O3S and a molecular weight of 290.36 g/mol. Its IUPAC name is (3aR,5R,6R,7R,7aR)-5-[(S)-cyclobutyl(hydroxy)methyl]-7-fluoro-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol.
| Compound Name | (3aR,5R,6R,7R,7aR)-5-[(S)-cyclobutyl(hydroxy)methyl]-7-fluoro-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol |
|---|---|
| PubChem CID | 136607190 |
| Molecular Formula | C12H19FN2O3S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (3aR,5R,6R,7R,7aR)-5-[(S)-cyclobutyl(hydroxy)methyl]-7-fluoro-2-methylimino-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazol-6-ol |
| SMILES | C/N=C1/N[C@@H]2[C@@H](F)[C@H](O)[C@@H]([C@@H](O)C3CCC3)O[C@@H]2S1 |
| InChI | InChI=1S/C12H19FN2O3S/c1-14-12-15-7-6(13)9(17)10(18-11(7)19-12)8(16)5-3-2-4-5/h5-11,16-17H,2-4H2,1H3,(H,14,15)/t6-,7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | WLJQSLNDQFCZQE-VFZPANTDSA-N |
| XLogP | 0.26 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|