About 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole
5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole (PubChem CID 136607458) has the molecular formula C20H17N3
and a molecular weight of 299.38 g/mol. Its IUPAC name is 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole |
| PubChem CID | 136607458 |
| Molecular Formula | C20H17N3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole |
| SMILES | Cc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1ccn[nH]1 |
| InChI | InChI=1S/C20H17N3/c1-14-18(17-12-13-21-23-17)19(15-8-4-2-5-9-15)20(22-14)16-10-6-3-7-11-16/h2-13,22H,1H3,(H,21,23) |
| InChIKey | GMNXEEJYFFLMRH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole?
The IUPAC name of 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole (CID 136607458) is 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole.
What is the SMILES notation for 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole?
The canonical SMILES for 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole is Cc1[nH]c(-c2ccccc2)c(-c2ccccc2)c1-c1ccn[nH]1.
What is the InChIKey of 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole?
The InChIKey is GMNXEEJYFFLMRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3/c1-14-18(17-12-13-21-23-17)19(15-8-4-2-5-9-15)20(22-14)16-10-6-3-7-11-16/h2-13,22H,1H3,(H,21,23).
What are the key properties of 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole?
5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole has a molecular weight of 299.38 g/mol, XLogP of 5.05, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-1H-pyrazole is sourced from PubChem (CID 136607458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).