C20H21N5O — CID 136607493
6-[6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridazin-3-yl]quinolin-7-ol (PubChem CID 136607493) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 6-[6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridazin-3-yl]quinolin-7-ol.
| Compound Name | 6-[6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridazin-3-yl]quinolin-7-ol |
|---|---|
| PubChem CID | 136607493 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 6-[6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridazin-3-yl]quinolin-7-ol |
| SMILES | CN1C[C@@H]2CN(c3ccc(-c4cc5cccnc5cc4O)nn3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H21N5O/c1-24-9-14-11-25(12-15(14)10-24)20-5-4-17(22-23-20)16-7-13-3-2-6-21-18(13)8-19(16)26/h2-8,14-15,26H,9-12H2,1H3/t14-,15+ |
| InChIKey | ZGLNAKXVXDWBKZ-GASCZTMLSA-N |
| XLogP | 2.40 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |