C32H49N3O3 — CID 136608054
4-[(1R)-1-(8-tert-butyl-2-cyclohexylimino-3-oxo-1,4-diazaspiro[4.5]decan-4-yl)-4,4-dimethylpentyl]benzoic acid (PubChem CID 136608054) has the molecular formula C32H49N3O3 and a molecular weight of 523.76 g/mol. Its IUPAC name is 4-[(1R)-1-(8-tert-butyl-2-cyclohexylimino-3-oxo-1,4-diazaspiro[4.5]decan-4-yl)-4,4-dimethylpentyl]benzoic acid.
| Compound Name | 4-[(1R)-1-(8-tert-butyl-2-cyclohexylimino-3-oxo-1,4-diazaspiro[4.5]decan-4-yl)-4,4-dimethylpentyl]benzoic acid |
|---|---|
| PubChem CID | 136608054 |
| Molecular Formula | C32H49N3O3 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.38 |
| IUPAC Name | 4-[(1R)-1-(8-tert-butyl-2-cyclohexylimino-3-oxo-1,4-diazaspiro[4.5]decan-4-yl)-4,4-dimethylpentyl]benzoic acid |
| SMILES | CC(C)(C)CC[C@H](c1ccc(C(=O)O)cc1)N1C(=O)/C(=N/C2CCCCC2)NC12CCC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C32H49N3O3/c1-30(2,3)19-18-26(22-12-14-23(15-13-22)29(37)38)35-28(36)27(33-25-10-8-7-9-11-25)34-32(35)20-16-24(17-21-32)31(4,5)6/h12-15,24-26H,7-11,16-21H2,1-6H3,(H,33,34)(H,37,38)/t24?,26-,32?/m1/s1 |
| InChIKey | KAIKEFLKIGPIQU-DWFCJCDYSA-N |
| XLogP | 7.35 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|