C26H25F6N3O4 — CID 136608263
[4-oxo-6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-3H-quinazolin-8-yl] 2,2,2-trifluoroacetate (PubChem CID 136608263) has the molecular formula C26H25F6N3O4 and a molecular weight of 557.49 g/mol. Its IUPAC name is [4-oxo-6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-3H-quinazolin-8-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-oxo-6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-3H-quinazolin-8-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 136608263 |
| Molecular Formula | C26H25F6N3O4 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | [4-oxo-6-[2-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethoxymethyl]phenyl]-3H-quinazolin-8-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cc(-c2ccccc2COCCC2CCN(CC(F)(F)F)CC2)cc2c(=O)[nH]cnc12)C(F)(F)F |
| InChI | InChI=1S/C26H25F6N3O4/c27-25(28,29)14-35-8-5-16(6-9-35)7-10-38-13-17-3-1-2-4-19(17)18-11-20-22(33-15-34-23(20)36)21(12-18)39-24(37)26(30,31)32/h1-4,11-12,15-16H,5-10,13-14H2,(H,33,34,36) |
| InChIKey | SXPBJIUAOAVLQZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|