C27H28N4O — CID 136609301
11-[4-(methylaminomethyl)phenyl]-12-(4-propan-2-ylphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 136609301) has the molecular formula C27H28N4O and a molecular weight of 424.55 g/mol. Its IUPAC name is 11-[4-(methylaminomethyl)phenyl]-12-(4-propan-2-ylphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | 11-[4-(methylaminomethyl)phenyl]-12-(4-propan-2-ylphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 136609301 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 11-[4-(methylaminomethyl)phenyl]-12-(4-propan-2-ylphenyl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | CNCc1ccc(C2Nc3cccc4c(=O)[nH]nc(c34)C2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H28N4O/c1-16(2)18-11-13-19(14-12-18)23-25(20-9-7-17(8-10-20)15-28-3)29-22-6-4-5-21-24(22)26(23)30-31-27(21)32/h4-14,16,23,25,28-29H,15H2,1-3H3,(H,31,32) |
| InChIKey | LNKHAIHSZFPICP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |