C43H29N5OS — CID 136609861
2-(4-methoxyphenyl)-17-phenyl-7,12-dipyridin-2-yl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene (PubChem CID 136609861) has the molecular formula C43H29N5OS and a molecular weight of 663.81 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-17-phenyl-7,12-dipyridin-2-yl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene.
| Compound Name | 2-(4-methoxyphenyl)-17-phenyl-7,12-dipyridin-2-yl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
|---|---|
| PubChem CID | 136609861 |
| Molecular Formula | C43H29N5OS |
| Molecular Weight | 663.81 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-17-phenyl-7,12-dipyridin-2-yl-21-thia-22,23,24-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,4,6(24),7,9,11,13(22),14,16,18-undecaene |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccccn4)c4ccc([nH]4)c(-c4ccccn4)c4nc(c(-c5ccccc5)c5ccc2s5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C43H29N5OS/c1-49-29-15-13-28(14-16-29)41-33-18-20-35(47-33)43(31-12-6-8-26-45-31)37-22-21-36(48-37)42(30-11-5-7-25-44-30)34-19-17-32(46-34)40(27-9-3-2-4-10-27)38-23-24-39(41)50-38/h2-26,48H,1H3/b40-32-,40-38-,41-33-,41-39-,42-34-,42-36-,43-35-,43-37- |
| InChIKey | NCXKROJZVDKLQD-BRNXZHICSA-N |
| XLogP | 10.86 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.81 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |