C24H21BrN4O4S — CID 136610609
2-[9-bromo-12-(4-methylpiperazin-1-yl)-6H-[1]benzothiolo[2,3-b][1,5]benzodiazepin-2-yl]but-2-enedioic acid (PubChem CID 136610609) has the molecular formula C24H21BrN4O4S and a molecular weight of 541.43 g/mol. Its IUPAC name is 2-[9-bromo-12-(4-methylpiperazin-1-yl)-6H-[1]benzothiolo[2,3-b][1,5]benzodiazepin-2-yl]but-2-enedioic acid.
| Compound Name | 2-[9-bromo-12-(4-methylpiperazin-1-yl)-6H-[1]benzothiolo[2,3-b][1,5]benzodiazepin-2-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 136610609 |
| Molecular Formula | C24H21BrN4O4S |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 2-[9-bromo-12-(4-methylpiperazin-1-yl)-6H-[1]benzothiolo[2,3-b][1,5]benzodiazepin-2-yl]but-2-enedioic acid |
| SMILES | CN1CCN(C2=Nc3cc(Br)ccc3Nc3sc4ccc(C(=CC(=O)O)C(=O)O)cc4c32)CC1 |
| InChI | InChI=1S/C24H21BrN4O4S/c1-28-6-8-29(9-7-28)22-21-16-10-13(15(24(32)33)12-20(30)31)2-5-19(16)34-23(21)27-17-4-3-14(25)11-18(17)26-22/h2-5,10-12,27H,6-9H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | MDBZWCFAAVAMMZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|