C19H22N4O2 — CID 136610771
tert-butyl 3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)cyclopentane-1-carboxylate (PubChem CID 136610771) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is tert-butyl 3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)cyclopentane-1-carboxylate.
| Compound Name | tert-butyl 3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 136610771 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl 3-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,10-hexaen-13-yl)cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(c2[nH]cnc3cnc4nccc4c23)C1 |
| InChI | InChI=1S/C19H22N4O2/c1-19(2,3)25-18(24)12-5-4-11(8-12)16-15-13-6-7-20-17(13)21-9-14(15)22-10-23-16/h6-7,9-12H,4-5,8H2,1-3H3,(H,22,23) |
| InChIKey | CWYNQJMEOMVRET-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |