C10H8N10O3 — CID 136611109
2-amino-9-(2-amino-6-oxo-1H-purin-9-yl)-1,7-dihydropurine-6,8-dione (PubChem CID 136611109) has the molecular formula C10H8N10O3 and a molecular weight of 316.24 g/mol. Its IUPAC name is 2-amino-9-(2-amino-6-oxo-1H-purin-9-yl)-1,7-dihydropurine-6,8-dione.
| Compound Name | 2-amino-9-(2-amino-6-oxo-1H-purin-9-yl)-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 136611109 |
| Molecular Formula | C10H8N10O3 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-amino-9-(2-amino-6-oxo-1H-purin-9-yl)-1,7-dihydropurine-6,8-dione |
| SMILES | Nc1nc2c(ncn2-n2c(=O)[nH]c3c(=O)[nH]c(N)nc32)c(=O)[nH]1 |
| InChI | InChI=1S/C10H8N10O3/c11-8-15-4-2(6(21)17-8)13-1-19(4)20-5-3(14-10(20)23)7(22)18-9(12)16-5/h1H,(H,14,23)(H3,11,15,17,21)(H3,12,16,18,22) |
| InChIKey | DWOUMLYAKNLHLS-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 199.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |