About 2-(methoxyiminomethyl)-3,5,6-trimethylphenol
2-(methoxyiminomethyl)-3,5,6-trimethylphenol (PubChem CID 136611269) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(methoxyiminomethyl)-3,5,6-trimethylphenol.
Molecular Properties
| Compound Name | 2-(methoxyiminomethyl)-3,5,6-trimethylphenol |
| PubChem CID | 136611269 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(methoxyiminomethyl)-3,5,6-trimethylphenol |
| SMILES | CON=Cc1c(C)cc(C)c(C)c1O |
| InChI | InChI=1S/C11H15NO2/c1-7-5-8(2)10(6-12-14-4)11(13)9(7)3/h5-6,13H,1-4H3 |
| InChIKey | JXCLBPKLUPXPRY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxyiminomethyl)-3,5,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxyiminomethyl)-3,5,6-trimethylphenol?
The IUPAC name of 2-(methoxyiminomethyl)-3,5,6-trimethylphenol (CID 136611269) is 2-(methoxyiminomethyl)-3,5,6-trimethylphenol.
What is the SMILES notation for 2-(methoxyiminomethyl)-3,5,6-trimethylphenol?
The canonical SMILES for 2-(methoxyiminomethyl)-3,5,6-trimethylphenol is CON=Cc1c(C)cc(C)c(C)c1O.
What is the InChIKey of 2-(methoxyiminomethyl)-3,5,6-trimethylphenol?
The InChIKey is JXCLBPKLUPXPRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-7-5-8(2)10(6-12-14-4)11(13)9(7)3/h5-6,13H,1-4H3.
What are the key properties of 2-(methoxyiminomethyl)-3,5,6-trimethylphenol?
2-(methoxyiminomethyl)-3,5,6-trimethylphenol has a molecular weight of 193.25 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxyiminomethyl)-3,5,6-trimethylphenol is sourced from PubChem (CID 136611269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).