C17H15IN3O4S- — CID 136611780
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-iodophenyl)-1,2,4-triazole-3-sulfinate (PubChem CID 136611780) has the molecular formula C17H15IN3O4S- and a molecular weight of 484.30 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-iodophenyl)-1,2,4-triazole-3-sulfinate.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-iodophenyl)-1,2,4-triazole-3-sulfinate |
|---|---|
| PubChem CID | 136611780 |
| Molecular Formula | C17H15IN3O4S- |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-iodophenyl)-1,2,4-triazole-3-sulfinate |
| SMILES | CC(C)c1cc(-c2nnc(S(=O)[O-])n2-c2ccc(I)cc2)c(O)cc1O |
| InChI | InChI=1S/C17H16IN3O4S/c1-9(2)12-7-13(15(23)8-14(12)22)16-19-20-17(26(24)25)21(16)11-5-3-10(18)4-6-11/h3-9,22-23H,1-2H3,(H,24,25)/p-1 |
| InChIKey | DHXWJAQNXKVOKW-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|