C12H18Cl2N6O2 — CID 136611931
4-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-ethoxyphenol;dihydrochloride (PubChem CID 136611931) has the molecular formula C12H18Cl2N6O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 4-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-ethoxyphenol;dihydrochloride.
| Compound Name | 4-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-ethoxyphenol;dihydrochloride |
|---|---|
| PubChem CID | 136611931 |
| Molecular Formula | C12H18Cl2N6O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-ethoxyphenol;dihydrochloride |
| SMILES | CCOc1cc(/C=N/Nc2nnc(C)n2N)ccc1O.Cl.Cl |
| InChI | InChI=1S/C12H16N6O2.2ClH/c1-3-20-11-6-9(4-5-10(11)19)7-14-16-12-17-15-8(2)18(12)13;;/h4-7,19H,3,13H2,1-2H3,(H,16,17);2*1H/b14-7+;; |
| InChIKey | SMXOJITVNRLRNO-MOEKMLTRSA-N |
| XLogP | 1.69 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|