C21H21N3O — CID 136612078
5-(dimethylamino)-2-[(diphenylhydrazinylidene)methyl]phenol (PubChem CID 136612078) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[(diphenylhydrazinylidene)methyl]phenol.
| Compound Name | 5-(dimethylamino)-2-[(diphenylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 136612078 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 5-(dimethylamino)-2-[(diphenylhydrazinylidene)methyl]phenol |
| SMILES | CN(C)c1ccc(C=NN(c2ccccc2)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H21N3O/c1-23(2)20-14-13-17(21(25)15-20)16-22-24(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16,25H,1-2H3 |
| InChIKey | OIBGKABVENGUHS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|